C15H12Br2N2O2S — CID 17094507
5-bromo-N-[(2-bromophenyl)carbamothioyl]-2-methoxybenzamide (PubChem CID 17094507) has the molecular formula C15H12Br2N2O2S and a molecular weight of 444.15 g/mol. Its IUPAC name is 5-bromo-N-[(2-bromophenyl)carbamothioyl]-2-methoxybenzamide.
| Compound Name | 5-bromo-N-[(2-bromophenyl)carbamothioyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 17094507 |
| Molecular Formula | C15H12Br2N2O2S |
| Molecular Weight | 444.15 g/mol |
| Exact Mass | 441.90 |
| IUPAC Name | 5-bromo-N-[(2-bromophenyl)carbamothioyl]-2-methoxybenzamide |
| SMILES | COc1ccc(Br)cc1C(=O)NC(=S)Nc1ccccc1Br |
| InChI | InChI=1S/C15H12Br2N2O2S/c1-21-13-7-6-9(16)8-10(13)14(20)19-15(22)18-12-5-3-2-4-11(12)17/h2-8H,1H3,(H2,18,19,20,22) |
| InChIKey | RCCNMHYEVMUIPI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.15 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|