C19H20BrN3O3S — CID 1290230
5-bromo-2-methoxy-N-[(2-morpholin-4-ylphenyl)carbamothioyl]benzamide (PubChem CID 1290230) has the molecular formula C19H20BrN3O3S and a molecular weight of 450.36 g/mol. Its IUPAC name is 5-bromo-2-methoxy-N-[(2-morpholin-4-ylphenyl)carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-methoxy-N-[(2-morpholin-4-ylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 1290230 |
| Molecular Formula | C19H20BrN3O3S |
| Molecular Weight | 450.36 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | 5-bromo-2-methoxy-N-[(2-morpholin-4-ylphenyl)carbamothioyl]benzamide |
| SMILES | COc1ccc(Br)cc1C(=O)NC(=S)Nc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C19H20BrN3O3S/c1-25-17-7-6-13(20)12-14(17)18(24)22-19(27)21-15-4-2-3-5-16(15)23-8-10-26-11-9-23/h2-7,12H,8-11H2,1H3,(H2,21,22,24,27) |
| InChIKey | HSBFMTGGADVIAN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|