C21H22BrN3O5S — CID 17336384
methyl 3-[(3-bromo-4-methoxybenzoyl)carbamothioylamino]-4-morpholin-4-ylbenzoate (PubChem CID 17336384) has the molecular formula C21H22BrN3O5S and a molecular weight of 508.39 g/mol. Its IUPAC name is methyl 3-[(3-bromo-4-methoxybenzoyl)carbamothioylamino]-4-morpholin-4-ylbenzoate.
| Compound Name | methyl 3-[(3-bromo-4-methoxybenzoyl)carbamothioylamino]-4-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 17336384 |
| Molecular Formula | C21H22BrN3O5S |
| Molecular Weight | 508.39 g/mol |
| Exact Mass | 507.05 |
| IUPAC Name | methyl 3-[(3-bromo-4-methoxybenzoyl)carbamothioylamino]-4-morpholin-4-ylbenzoate |
| SMILES | COC(=O)c1ccc(N2CCOCC2)c(NC(=S)NC(=O)c2ccc(OC)c(Br)c2)c1 |
| InChI | InChI=1S/C21H22BrN3O5S/c1-28-18-6-4-13(11-15(18)22)19(26)24-21(31)23-16-12-14(20(27)29-2)3-5-17(16)25-7-9-30-10-8-25/h3-6,11-12H,7-10H2,1-2H3,(H2,23,24,26,31) |
| InChIKey | VPNKCAIZYSKYKW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|