C24H29N3O5S — CID 17336542
methyl 3-[(3-butan-2-yloxybenzoyl)carbamothioylamino]-4-morpholin-4-ylbenzoate (PubChem CID 17336542) has the molecular formula C24H29N3O5S and a molecular weight of 471.58 g/mol. Its IUPAC name is methyl 3-[(3-butan-2-yloxybenzoyl)carbamothioylamino]-4-morpholin-4-ylbenzoate.
| Compound Name | methyl 3-[(3-butan-2-yloxybenzoyl)carbamothioylamino]-4-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 17336542 |
| Molecular Formula | C24H29N3O5S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | methyl 3-[(3-butan-2-yloxybenzoyl)carbamothioylamino]-4-morpholin-4-ylbenzoate |
| SMILES | CCC(C)Oc1cccc(C(=O)NC(=S)Nc2cc(C(=O)OC)ccc2N2CCOCC2)c1 |
| InChI | InChI=1S/C24H29N3O5S/c1-4-16(2)32-19-7-5-6-17(14-19)22(28)26-24(33)25-20-15-18(23(29)30-3)8-9-21(20)27-10-12-31-13-11-27/h5-9,14-16H,4,10-13H2,1-3H3,(H2,25,26,28,33) |
| InChIKey | GPLMCPWGMPIQPO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|