C24H27N5O7S — CID 17336538
methyl 4-morpholin-4-yl-3-[(2-morpholin-4-yl-5-nitrobenzoyl)carbamothioylamino]benzoate (PubChem CID 17336538) has the molecular formula C24H27N5O7S and a molecular weight of 529.58 g/mol. Its IUPAC name is methyl 4-morpholin-4-yl-3-[(2-morpholin-4-yl-5-nitrobenzoyl)carbamothioylamino]benzoate.
| Compound Name | methyl 4-morpholin-4-yl-3-[(2-morpholin-4-yl-5-nitrobenzoyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 17336538 |
| Molecular Formula | C24H27N5O7S |
| Molecular Weight | 529.58 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | methyl 4-morpholin-4-yl-3-[(2-morpholin-4-yl-5-nitrobenzoyl)carbamothioylamino]benzoate |
| SMILES | COC(=O)c1ccc(N2CCOCC2)c(NC(=S)NC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)c1 |
| InChI | InChI=1S/C24H27N5O7S/c1-34-23(31)16-2-4-21(28-8-12-36-13-9-28)19(14-16)25-24(37)26-22(30)18-15-17(29(32)33)3-5-20(18)27-6-10-35-11-7-27/h2-5,14-15H,6-13H2,1H3,(H2,25,26,30,37) |
| InChIKey | WNKNNAGBIVAZRQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.58 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|