C25H20N2O2S — CID 1343934
N-(1,2-dihydroacenaphthylen-5-ylcarbamothioyl)-3-methoxynaphthalene-2-carboxamide (PubChem CID 1343934) has the molecular formula C25H20N2O2S and a molecular weight of 412.51 g/mol. Its IUPAC name is N-(1,2-dihydroacenaphthylen-5-ylcarbamothioyl)-3-methoxynaphthalene-2-carboxamide.
| Compound Name | N-(1,2-dihydroacenaphthylen-5-ylcarbamothioyl)-3-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 1343934 |
| Molecular Formula | C25H20N2O2S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | N-(1,2-dihydroacenaphthylen-5-ylcarbamothioyl)-3-methoxynaphthalene-2-carboxamide |
| SMILES | COc1cc2ccccc2cc1C(=O)NC(=S)Nc1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C25H20N2O2S/c1-29-22-14-18-6-3-2-5-17(18)13-20(22)24(28)27-25(30)26-21-12-11-16-10-9-15-7-4-8-19(21)23(15)16/h2-8,11-14H,9-10H2,1H3,(H2,26,27,28,30) |
| InChIKey | VGWJMUDZWTYZJV-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|