C22H20N2OS — CID 1287902
N-(1,2-dihydroacenaphthylen-5-ylcarbamothioyl)-2,4-dimethylbenzamide (PubChem CID 1287902) has the molecular formula C22H20N2OS and a molecular weight of 360.48 g/mol. Its IUPAC name is N-(1,2-dihydroacenaphthylen-5-ylcarbamothioyl)-2,4-dimethylbenzamide.
| Compound Name | N-(1,2-dihydroacenaphthylen-5-ylcarbamothioyl)-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 1287902 |
| Molecular Formula | C22H20N2OS |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | N-(1,2-dihydroacenaphthylen-5-ylcarbamothioyl)-2,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2ccc3c4c(cccc24)CC3)c(C)c1 |
| InChI | InChI=1S/C22H20N2OS/c1-13-6-10-17(14(2)12-13)21(25)24-22(26)23-19-11-9-16-8-7-15-4-3-5-18(19)20(15)16/h3-6,9-12H,7-8H2,1-2H3,(H2,23,24,25,26) |
| InChIKey | GNTPQEHUROGOPT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|