C16H14Cl2N2O2S — CID 1395879
N-[(3,5-dichloro-2-hydroxyphenyl)carbamothioyl]-2,4-dimethylbenzamide (PubChem CID 1395879) has the molecular formula C16H14Cl2N2O2S and a molecular weight of 369.27 g/mol. Its IUPAC name is N-[(3,5-dichloro-2-hydroxyphenyl)carbamothioyl]-2,4-dimethylbenzamide.
| Compound Name | N-[(3,5-dichloro-2-hydroxyphenyl)carbamothioyl]-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 1395879 |
| Molecular Formula | C16H14Cl2N2O2S |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | N-[(3,5-dichloro-2-hydroxyphenyl)carbamothioyl]-2,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2cc(Cl)cc(Cl)c2O)c(C)c1 |
| InChI | InChI=1S/C16H14Cl2N2O2S/c1-8-3-4-11(9(2)5-8)15(22)20-16(23)19-13-7-10(17)6-12(18)14(13)21/h3-7,21H,1-2H3,(H2,19,20,22,23) |
| InChIKey | YJISUZRALPUMPS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|