C18H18Cl2N2O3S — CID 22776079
N-[(3,5-dichloro-2-hydroxyphenyl)carbamothioyl]-4-(2-methylpropoxy)benzamide (PubChem CID 22776079) has the molecular formula C18H18Cl2N2O3S and a molecular weight of 413.33 g/mol. Its IUPAC name is N-[(3,5-dichloro-2-hydroxyphenyl)carbamothioyl]-4-(2-methylpropoxy)benzamide.
| Compound Name | N-[(3,5-dichloro-2-hydroxyphenyl)carbamothioyl]-4-(2-methylpropoxy)benzamide |
|---|---|
| PubChem CID | 22776079 |
| Molecular Formula | C18H18Cl2N2O3S |
| Molecular Weight | 413.33 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | N-[(3,5-dichloro-2-hydroxyphenyl)carbamothioyl]-4-(2-methylpropoxy)benzamide |
| SMILES | CC(C)COc1ccc(C(=O)NC(=S)Nc2cc(Cl)cc(Cl)c2O)cc1 |
| InChI | InChI=1S/C18H18Cl2N2O3S/c1-10(2)9-25-13-5-3-11(4-6-13)17(24)22-18(26)21-15-8-12(19)7-14(20)16(15)23/h3-8,10,23H,9H2,1-2H3,(H2,21,22,24,26) |
| InChIKey | NOEAOLUWYIWBQM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.33 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|