C21H25N3O3S — CID 4937584
N,N-dimethyl-2-[[4-(2-methylpropoxy)benzoyl]carbamothioylamino]benzamide (PubChem CID 4937584) has the molecular formula C21H25N3O3S and a molecular weight of 399.52 g/mol. Its IUPAC name is N,N-dimethyl-2-[[4-(2-methylpropoxy)benzoyl]carbamothioylamino]benzamide.
| Compound Name | N,N-dimethyl-2-[[4-(2-methylpropoxy)benzoyl]carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 4937584 |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | N,N-dimethyl-2-[[4-(2-methylpropoxy)benzoyl]carbamothioylamino]benzamide |
| SMILES | CC(C)COc1ccc(C(=O)NC(=S)Nc2ccccc2C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C21H25N3O3S/c1-14(2)13-27-16-11-9-15(10-12-16)19(25)23-21(28)22-18-8-6-5-7-17(18)20(26)24(3)4/h5-12,14H,13H2,1-4H3,(H2,22,23,25,28) |
| InChIKey | CIWCXLIAUGGUIF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|