C11H7F4N3O2 — CID 63037708
N-(cyanomethyl)-N'-[2-fluoro-5-(trifluoromethyl)phenyl]oxamide (PubChem CID 63037708) has the molecular formula C11H7F4N3O2 and a molecular weight of 289.19 g/mol. Its IUPAC name is N-(cyanomethyl)-N'-[2-fluoro-5-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N-(cyanomethyl)-N'-[2-fluoro-5-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 63037708 |
| Molecular Formula | C11H7F4N3O2 |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | N-(cyanomethyl)-N'-[2-fluoro-5-(trifluoromethyl)phenyl]oxamide |
| SMILES | N#CCNC(=O)C(=O)Nc1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C11H7F4N3O2/c12-7-2-1-6(11(13,14)15)5-8(7)18-10(20)9(19)17-4-3-16/h1-2,5H,4H2,(H,17,19)(H,18,20) |
| InChIKey | OPKCTYYGNDQGJD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|