C13H14F4N2O3 — CID 110930863
N-[2-fluoro-5-(trifluoromethyl)phenyl]-N'-(1-hydroxybutan-2-yl)oxamide (PubChem CID 110930863) has the molecular formula C13H14F4N2O3 and a molecular weight of 322.26 g/mol. Its IUPAC name is N-[2-fluoro-5-(trifluoromethyl)phenyl]-N'-(1-hydroxybutan-2-yl)oxamide.
| Compound Name | N-[2-fluoro-5-(trifluoromethyl)phenyl]-N'-(1-hydroxybutan-2-yl)oxamide |
|---|---|
| PubChem CID | 110930863 |
| Molecular Formula | C13H14F4N2O3 |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | N-[2-fluoro-5-(trifluoromethyl)phenyl]-N'-(1-hydroxybutan-2-yl)oxamide |
| SMILES | CCC(CO)NC(=O)C(=O)Nc1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C13H14F4N2O3/c1-2-8(6-20)18-11(21)12(22)19-10-5-7(13(15,16)17)3-4-9(10)14/h3-5,8,20H,2,6H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | VJYJHCMJEWNZPF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|