C10H6F3N3O2 — CID 62811653
N-(cyanomethyl)-N'-(3,4,5-trifluorophenyl)oxamide (PubChem CID 62811653) has the molecular formula C10H6F3N3O2 and a molecular weight of 257.17 g/mol. Its IUPAC name is N-(cyanomethyl)-N'-(3,4,5-trifluorophenyl)oxamide.
| Compound Name | N-(cyanomethyl)-N'-(3,4,5-trifluorophenyl)oxamide |
|---|---|
| PubChem CID | 62811653 |
| Molecular Formula | C10H6F3N3O2 |
| Molecular Weight | 257.17 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | N-(cyanomethyl)-N'-(3,4,5-trifluorophenyl)oxamide |
| SMILES | N#CCNC(=O)C(=O)Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C10H6F3N3O2/c11-6-3-5(4-7(12)8(6)13)16-10(18)9(17)15-2-1-14/h3-4H,2H2,(H,15,17)(H,16,18) |
| InChIKey | XMFCEXBEYBMVCN-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.17 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|