C12H8N4O4 — CID 43316088
N-(cyanomethyl)-N'-(1,3-dioxoisoindol-5-yl)oxamide (PubChem CID 43316088) has the molecular formula C12H8N4O4 and a molecular weight of 272.22 g/mol. Its IUPAC name is N-(cyanomethyl)-N'-(1,3-dioxoisoindol-5-yl)oxamide.
| Compound Name | N-(cyanomethyl)-N'-(1,3-dioxoisoindol-5-yl)oxamide |
|---|---|
| PubChem CID | 43316088 |
| Molecular Formula | C12H8N4O4 |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | N-(cyanomethyl)-N'-(1,3-dioxoisoindol-5-yl)oxamide |
| SMILES | N#CCNC(=O)C(=O)Nc1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C12H8N4O4/c13-3-4-14-11(19)12(20)15-6-1-2-7-8(5-6)10(18)16-9(7)17/h1-2,5H,4H2,(H,14,19)(H,15,20)(H,16,17,18) |
| InChIKey | LFVFEPPZMWKTDX-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 128.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|