C18H16N2O6 — CID 2230182
N-(1,3-dioxoisoindol-5-yl)-3,4,5-trimethoxybenzamide (PubChem CID 2230182) has the molecular formula C18H16N2O6 and a molecular weight of 356.33 g/mol. Its IUPAC name is N-(1,3-dioxoisoindol-5-yl)-3,4,5-trimethoxybenzamide.
| Compound Name | N-(1,3-dioxoisoindol-5-yl)-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 2230182 |
| Molecular Formula | C18H16N2O6 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | N-(1,3-dioxoisoindol-5-yl)-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc3c(c2)C(=O)NC3=O)cc(OC)c1OC |
| InChI | InChI=1S/C18H16N2O6/c1-24-13-6-9(7-14(25-2)15(13)26-3)16(21)19-10-4-5-11-12(8-10)18(23)20-17(11)22/h4-8H,1-3H3,(H,19,21)(H,20,22,23) |
| InChIKey | CPLQDFSVGINENX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|