C17H16INO6 — CID 2974192
2-iodo-5-[(3,4,5-trimethoxybenzoyl)amino]benzoic acid (PubChem CID 2974192) has the molecular formula C17H16INO6 and a molecular weight of 457.22 g/mol. Its IUPAC name is 2-iodo-5-[(3,4,5-trimethoxybenzoyl)amino]benzoic acid.
| Compound Name | 2-iodo-5-[(3,4,5-trimethoxybenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 2974192 |
| Molecular Formula | C17H16INO6 |
| Molecular Weight | 457.22 g/mol |
| Exact Mass | 457.00 |
| IUPAC Name | 2-iodo-5-[(3,4,5-trimethoxybenzoyl)amino]benzoic acid |
| SMILES | COc1cc(C(=O)Nc2ccc(I)c(C(=O)O)c2)cc(OC)c1OC |
| InChI | InChI=1S/C17H16INO6/c1-23-13-6-9(7-14(24-2)15(13)25-3)16(20)19-10-4-5-12(18)11(8-10)17(21)22/h4-8H,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | ZGYVYMUZYPVPON-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.22 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|