C11H11N3O4S — CID 43315997
N-(cyanomethyl)-N'-(4-methylsulfonylphenyl)oxamide (PubChem CID 43315997) has the molecular formula C11H11N3O4S and a molecular weight of 281.29 g/mol. Its IUPAC name is N-(cyanomethyl)-N'-(4-methylsulfonylphenyl)oxamide.
| Compound Name | N-(cyanomethyl)-N'-(4-methylsulfonylphenyl)oxamide |
|---|---|
| PubChem CID | 43315997 |
| Molecular Formula | C11H11N3O4S |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | N-(cyanomethyl)-N'-(4-methylsulfonylphenyl)oxamide |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)C(=O)NCC#N)cc1 |
| InChI | InChI=1S/C11H11N3O4S/c1-19(17,18)9-4-2-8(3-5-9)14-11(16)10(15)13-7-6-12/h2-5H,7H2,1H3,(H,13,15)(H,14,16) |
| InChIKey | FFSMHEUPGLXIMO-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|