C11H10ClN3O3 — CID 107621880
N'-(4-chloro-3-methoxyphenyl)-N-(cyanomethyl)oxamide (PubChem CID 107621880) has the molecular formula C11H10ClN3O3 and a molecular weight of 267.67 g/mol. Its IUPAC name is N'-(4-chloro-3-methoxyphenyl)-N-(cyanomethyl)oxamide.
| Compound Name | N'-(4-chloro-3-methoxyphenyl)-N-(cyanomethyl)oxamide |
|---|---|
| PubChem CID | 107621880 |
| Molecular Formula | C11H10ClN3O3 |
| Molecular Weight | 267.67 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | N'-(4-chloro-3-methoxyphenyl)-N-(cyanomethyl)oxamide |
| SMILES | COc1cc(NC(=O)C(=O)NCC#N)ccc1Cl |
| InChI | InChI=1S/C11H10ClN3O3/c1-18-9-6-7(2-3-8(9)12)15-11(17)10(16)14-5-4-13/h2-3,6H,5H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | RIJQSPAQQWZVHQ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.67 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|