C9H8N4O2 — CID 43315640
N-(cyanomethyl)-N'-pyridin-3-yloxamide (PubChem CID 43315640) has the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. Its IUPAC name is N-(cyanomethyl)-N'-pyridin-3-yloxamide.
| Compound Name | N-(cyanomethyl)-N'-pyridin-3-yloxamide |
|---|---|
| PubChem CID | 43315640 |
| Molecular Formula | C9H8N4O2 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | N-(cyanomethyl)-N'-pyridin-3-yloxamide |
| SMILES | N#CCNC(=O)C(=O)Nc1cccnc1 |
| InChI | InChI=1S/C9H8N4O2/c10-3-5-12-8(14)9(15)13-7-2-1-4-11-6-7/h1-2,4,6H,5H2,(H,12,14)(H,13,15) |
| InChIKey | QWEOCKMNMCMPOP-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|