C13H17N3O3S — CID 97414759
N-[[(3S)-3-methoxythiolan-3-yl]methyl]-N'-pyridin-3-yloxamide (PubChem CID 97414759) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is N-[[(3S)-3-methoxythiolan-3-yl]methyl]-N'-pyridin-3-yloxamide.
| Compound Name | N-[[(3S)-3-methoxythiolan-3-yl]methyl]-N'-pyridin-3-yloxamide |
|---|---|
| PubChem CID | 97414759 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | N-[[(3S)-3-methoxythiolan-3-yl]methyl]-N'-pyridin-3-yloxamide |
| SMILES | CO[C@]1(CNC(=O)C(=O)Nc2cccnc2)CCSC1 |
| InChI | InChI=1S/C13H17N3O3S/c1-19-13(4-6-20-9-13)8-15-11(17)12(18)16-10-3-2-5-14-7-10/h2-3,5,7H,4,6,8-9H2,1H3,(H,15,17)(H,16,18)/t13-/m0/s1 |
| InChIKey | UBLMCHPXGOAXFW-ZDUSSCGKSA-N |
| XLogP | 0.66 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|