C15H17F3N2O3S — CID 90584491
N-[(3-methoxythiolan-3-yl)methyl]-N'-[2-(trifluoromethyl)phenyl]oxamide (PubChem CID 90584491) has the molecular formula C15H17F3N2O3S and a molecular weight of 362.37 g/mol. Its IUPAC name is N-[(3-methoxythiolan-3-yl)methyl]-N'-[2-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N-[(3-methoxythiolan-3-yl)methyl]-N'-[2-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 90584491 |
| Molecular Formula | C15H17F3N2O3S |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | N-[(3-methoxythiolan-3-yl)methyl]-N'-[2-(trifluoromethyl)phenyl]oxamide |
| SMILES | COC1(CNC(=O)C(=O)Nc2ccccc2C(F)(F)F)CCSC1 |
| InChI | InChI=1S/C15H17F3N2O3S/c1-23-14(6-7-24-9-14)8-19-12(21)13(22)20-11-5-3-2-4-10(11)15(16,17)18/h2-5H,6-9H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | WLPLBHDGKCPKHW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|