C16H26N2O3S — CID 124522785
N-[2-(cyclohexen-1-yl)ethyl]-N'-[[(3S)-3-methoxythiolan-3-yl]methyl]oxamide (PubChem CID 124522785) has the molecular formula C16H26N2O3S and a molecular weight of 326.46 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-N'-[[(3S)-3-methoxythiolan-3-yl]methyl]oxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-N'-[[(3S)-3-methoxythiolan-3-yl]methyl]oxamide |
|---|---|
| PubChem CID | 124522785 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-N'-[[(3S)-3-methoxythiolan-3-yl]methyl]oxamide |
| SMILES | CO[C@]1(CNC(=O)C(=O)NCCC2=CCCCC2)CCSC1 |
| InChI | InChI=1S/C16H26N2O3S/c1-21-16(8-10-22-12-16)11-18-15(20)14(19)17-9-7-13-5-3-2-4-6-13/h5H,2-4,6-12H2,1H3,(H,17,19)(H,18,20)/t16-/m0/s1 |
| InChIKey | UNMQRTQXTAPUOZ-INIZCTEOSA-N |
| XLogP | 1.63 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|