C16H26N2O3S2 — CID 146080769
N-[2-(cyclohexen-1-yl)ethyl]-N'-[(6-hydroxy-1,4-dithiepan-6-yl)methyl]oxamide (PubChem CID 146080769) has the molecular formula C16H26N2O3S2 and a molecular weight of 358.53 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-N'-[(6-hydroxy-1,4-dithiepan-6-yl)methyl]oxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-N'-[(6-hydroxy-1,4-dithiepan-6-yl)methyl]oxamide |
|---|---|
| PubChem CID | 146080769 |
| Molecular Formula | C16H26N2O3S2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-N'-[(6-hydroxy-1,4-dithiepan-6-yl)methyl]oxamide |
| SMILES | O=C(NCCC1=CCCCC1)C(=O)NCC1(O)CSCCSC1 |
| InChI | InChI=1S/C16H26N2O3S2/c19-14(17-7-6-13-4-2-1-3-5-13)15(20)18-10-16(21)11-22-8-9-23-12-16/h4,21H,1-3,5-12H2,(H,17,19)(H,18,20) |
| InChIKey | CYYRWWKLKZAGJK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|