C17H24N2O3S — CID 56764065
N-[2-(cyclohexen-1-yl)ethyl]-N'-[2-hydroxy-2-(3-methylthiophen-2-yl)ethyl]oxamide (PubChem CID 56764065) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-N'-[2-hydroxy-2-(3-methylthiophen-2-yl)ethyl]oxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-N'-[2-hydroxy-2-(3-methylthiophen-2-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 56764065 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-N'-[2-hydroxy-2-(3-methylthiophen-2-yl)ethyl]oxamide |
| SMILES | Cc1ccsc1C(O)CNC(=O)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C17H24N2O3S/c1-12-8-10-23-15(12)14(20)11-19-17(22)16(21)18-9-7-13-5-3-2-4-6-13/h5,8,10,14,20H,2-4,6-7,9,11H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | KQJUZQYFHJLMTJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|