C16H17N3O4 — CID 108526026
N-[2-(4-methoxyphenoxy)ethyl]-N'-pyridin-3-yloxamide (PubChem CID 108526026) has the molecular formula C16H17N3O4 and a molecular weight of 315.33 g/mol. Its IUPAC name is N-[2-(4-methoxyphenoxy)ethyl]-N'-pyridin-3-yloxamide.
| Compound Name | N-[2-(4-methoxyphenoxy)ethyl]-N'-pyridin-3-yloxamide |
|---|---|
| PubChem CID | 108526026 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | N-[2-(4-methoxyphenoxy)ethyl]-N'-pyridin-3-yloxamide |
| SMILES | COc1ccc(OCCNC(=O)C(=O)Nc2cccnc2)cc1 |
| InChI | InChI=1S/C16H17N3O4/c1-22-13-4-6-14(7-5-13)23-10-9-18-15(20)16(21)19-12-3-2-8-17-11-12/h2-8,11H,9-10H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | IKKKEPIBLDQPDT-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|