C18H20N2O4 — CID 110415100
N-[2-(4-methoxyphenoxy)ethyl]-4-oxo-4-pyridin-3-ylbutanamide (PubChem CID 110415100) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is N-[2-(4-methoxyphenoxy)ethyl]-4-oxo-4-pyridin-3-ylbutanamide.
| Compound Name | N-[2-(4-methoxyphenoxy)ethyl]-4-oxo-4-pyridin-3-ylbutanamide |
|---|---|
| PubChem CID | 110415100 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | N-[2-(4-methoxyphenoxy)ethyl]-4-oxo-4-pyridin-3-ylbutanamide |
| SMILES | COc1ccc(OCCNC(=O)CCC(=O)c2cccnc2)cc1 |
| InChI | InChI=1S/C18H20N2O4/c1-23-15-4-6-16(7-5-15)24-12-11-20-18(22)9-8-17(21)14-3-2-10-19-13-14/h2-7,10,13H,8-9,11-12H2,1H3,(H,20,22) |
| InChIKey | RKNFBZLSEMOGJE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|