C16H17N3O4S — CID 51552612
N-(4-methoxyphenyl)-2-[(R)-[2-oxo-2-(pyridin-3-ylamino)ethyl]sulfinyl]acetamide (PubChem CID 51552612) has the molecular formula C16H17N3O4S and a molecular weight of 347.40 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-[(R)-[2-oxo-2-(pyridin-3-ylamino)ethyl]sulfinyl]acetamide.
| Compound Name | N-(4-methoxyphenyl)-2-[(R)-[2-oxo-2-(pyridin-3-ylamino)ethyl]sulfinyl]acetamide |
|---|---|
| PubChem CID | 51552612 |
| Molecular Formula | C16H17N3O4S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | N-(4-methoxyphenyl)-2-[(R)-[2-oxo-2-(pyridin-3-ylamino)ethyl]sulfinyl]acetamide |
| SMILES | COc1ccc(NC(=O)C[S@@](=O)CC(=O)Nc2cccnc2)cc1 |
| InChI | InChI=1S/C16H17N3O4S/c1-23-14-6-4-12(5-7-14)18-15(20)10-24(22)11-16(21)19-13-3-2-8-17-9-13/h2-9H,10-11H2,1H3,(H,18,20)(H,19,21)/t24-/m1/s1 |
| InChIKey | ZIZIWQWVXLSWTR-XMMPIXPASA-N |
| XLogP | 1.42 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |