About N-(4-acetylphenyl)-N'-pyridin-3-yloxamide
N-(4-acetylphenyl)-N'-pyridin-3-yloxamide (PubChem CID 108514790) has the molecular formula C15H13N3O3
and a molecular weight of 283.29 g/mol. Its IUPAC name is N-(4-acetylphenyl)-N'-pyridin-3-yloxamide.
Molecular Properties
| Compound Name | N-(4-acetylphenyl)-N'-pyridin-3-yloxamide |
| PubChem CID | 108514790 |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | N-(4-acetylphenyl)-N'-pyridin-3-yloxamide |
| SMILES | CC(=O)c1ccc(NC(=O)C(=O)Nc2cccnc2)cc1 |
| InChI | InChI=1S/C15H13N3O3/c1-10(19)11-4-6-12(7-5-11)17-14(20)15(21)18-13-3-2-8-16-9-13/h2-9H,1H3,(H,17,20)(H,18,21) |
| InChIKey | AWIGYNRDXZRXRG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(4-acetylphenyl)-N'-pyridin-3-yloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-acetylphenyl)-N'-pyridin-3-yloxamide?
The IUPAC name of N-(4-acetylphenyl)-N'-pyridin-3-yloxamide (CID 108514790) is N-(4-acetylphenyl)-N'-pyridin-3-yloxamide.
What is the SMILES notation for N-(4-acetylphenyl)-N'-pyridin-3-yloxamide?
The canonical SMILES for N-(4-acetylphenyl)-N'-pyridin-3-yloxamide is CC(=O)c1ccc(NC(=O)C(=O)Nc2cccnc2)cc1.
What is the InChIKey of N-(4-acetylphenyl)-N'-pyridin-3-yloxamide?
The InChIKey is AWIGYNRDXZRXRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3O3/c1-10(19)11-4-6-12(7-5-11)17-14(20)15(21)18-13-3-2-8-16-9-13/h2-9H,1H3,(H,17,20)(H,18,21).
What are the key properties of N-(4-acetylphenyl)-N'-pyridin-3-yloxamide?
N-(4-acetylphenyl)-N'-pyridin-3-yloxamide has a molecular weight of 283.29 g/mol, XLogP of 1.86, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-acetylphenyl)-N'-pyridin-3-yloxamide is sourced from PubChem (CID 108514790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).