C14H17N3O3 — CID 61174389
(2S)-2-amino-N-(1,3-dioxoisoindol-5-yl)-3-methylpentanamide (PubChem CID 61174389) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is (2S)-2-amino-N-(1,3-dioxoisoindol-5-yl)-3-methylpentanamide.
| Compound Name | (2S)-2-amino-N-(1,3-dioxoisoindol-5-yl)-3-methylpentanamide |
|---|---|
| PubChem CID | 61174389 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (2S)-2-amino-N-(1,3-dioxoisoindol-5-yl)-3-methylpentanamide |
| SMILES | CCC(C)[C@H](N)C(=O)Nc1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C14H17N3O3/c1-3-7(2)11(15)14(20)16-8-4-5-9-10(6-8)13(19)17-12(9)18/h4-7,11H,3,15H2,1-2H3,(H,16,20)(H,17,18,19)/t7?,11-/m0/s1 |
| InChIKey | RQBFDLMXFNOCHA-QRIDDKLISA-N |
| XLogP | 0.88 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|