C14H17N3O3 — CID 81072000
3-(aminomethyl)-N-(1,3-dioxoisoindol-5-yl)pentanamide (PubChem CID 81072000) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(1,3-dioxoisoindol-5-yl)pentanamide.
| Compound Name | 3-(aminomethyl)-N-(1,3-dioxoisoindol-5-yl)pentanamide |
|---|---|
| PubChem CID | 81072000 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 3-(aminomethyl)-N-(1,3-dioxoisoindol-5-yl)pentanamide |
| SMILES | CCC(CN)CC(=O)Nc1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C14H17N3O3/c1-2-8(7-15)5-12(18)16-9-3-4-10-11(6-9)14(20)17-13(10)19/h3-4,6,8H,2,5,7,15H2,1H3,(H,16,18)(H,17,19,20) |
| InChIKey | JENLTLXBLCPZBE-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|