C7H4Br2N2 — CID 10540383
(2,5-dibromophenyl)cyanamide (PubChem CID 10540383) has the molecular formula C7H4Br2N2 and a molecular weight of 275.93 g/mol. Its IUPAC name is (2,5-dibromophenyl)cyanamide.
| Compound Name | (2,5-dibromophenyl)cyanamide |
|---|---|
| PubChem CID | 10540383 |
| Molecular Formula | C7H4Br2N2 |
| Molecular Weight | 275.93 g/mol |
| Exact Mass | 273.87 |
| IUPAC Name | (2,5-dibromophenyl)cyanamide |
| SMILES | N#CNc1cc(Br)ccc1Br |
| InChI | InChI=1S/C7H4Br2N2/c8-5-1-2-6(9)7(3-5)11-4-10/h1-3,11H |
| InChIKey | CAHIZDJGWRFUGJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.93 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|