C14H10Br2N2 — CID 114016820
2-(2,5-dibromoanilino)-5-methylbenzonitrile (PubChem CID 114016820) has the molecular formula C14H10Br2N2 and a molecular weight of 366.06 g/mol. Its IUPAC name is 2-(2,5-dibromoanilino)-5-methylbenzonitrile.
| Compound Name | 2-(2,5-dibromoanilino)-5-methylbenzonitrile |
|---|---|
| PubChem CID | 114016820 |
| Molecular Formula | C14H10Br2N2 |
| Molecular Weight | 366.06 g/mol |
| Exact Mass | 363.92 |
| IUPAC Name | 2-(2,5-dibromoanilino)-5-methylbenzonitrile |
| SMILES | Cc1ccc(Nc2cc(Br)ccc2Br)c(C#N)c1 |
| InChI | InChI=1S/C14H10Br2N2/c1-9-2-5-13(10(6-9)8-17)18-14-7-11(15)3-4-12(14)16/h2-7,18H,1H3 |
| InChIKey | WXLZUPVYZNNXBW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.06 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |