C12H6Br2ClN3 — CID 83073282
2-chloro-6-(2,5-dibromoanilino)pyridine-4-carbonitrile (PubChem CID 83073282) has the molecular formula C12H6Br2ClN3 and a molecular weight of 387.46 g/mol. Its IUPAC name is 2-chloro-6-(2,5-dibromoanilino)pyridine-4-carbonitrile.
| Compound Name | 2-chloro-6-(2,5-dibromoanilino)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 83073282 |
| Molecular Formula | C12H6Br2ClN3 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 384.86 |
| IUPAC Name | 2-chloro-6-(2,5-dibromoanilino)pyridine-4-carbonitrile |
| SMILES | N#Cc1cc(Cl)nc(Nc2cc(Br)ccc2Br)c1 |
| InChI | InChI=1S/C12H6Br2ClN3/c13-8-1-2-9(14)10(5-8)17-12-4-7(6-16)3-11(15)18-12/h1-5H,(H,17,18) |
| InChIKey | CUDNEWUMHBTGFK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|