C14H11BrClN3 — CID 83072667
2-[1-(3-bromophenyl)ethylamino]-6-chloropyridine-4-carbonitrile (PubChem CID 83072667) has the molecular formula C14H11BrClN3 and a molecular weight of 336.62 g/mol. Its IUPAC name is 2-[1-(3-bromophenyl)ethylamino]-6-chloropyridine-4-carbonitrile.
| Compound Name | 2-[1-(3-bromophenyl)ethylamino]-6-chloropyridine-4-carbonitrile |
|---|---|
| PubChem CID | 83072667 |
| Molecular Formula | C14H11BrClN3 |
| Molecular Weight | 336.62 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | 2-[1-(3-bromophenyl)ethylamino]-6-chloropyridine-4-carbonitrile |
| SMILES | CC(Nc1cc(C#N)cc(Cl)n1)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H11BrClN3/c1-9(11-3-2-4-12(15)7-11)18-14-6-10(8-17)5-13(16)19-14/h2-7,9H,1H3,(H,18,19) |
| InChIKey | YZAMBWROVDOOPA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.62 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|