C14H12ClN3O — CID 83077491
2-chloro-6-[(2-hydroxy-1-phenylethyl)amino]pyridine-4-carbonitrile (PubChem CID 83077491) has the molecular formula C14H12ClN3O and a molecular weight of 273.72 g/mol. Its IUPAC name is 2-chloro-6-[(2-hydroxy-1-phenylethyl)amino]pyridine-4-carbonitrile.
| Compound Name | 2-chloro-6-[(2-hydroxy-1-phenylethyl)amino]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 83077491 |
| Molecular Formula | C14H12ClN3O |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 2-chloro-6-[(2-hydroxy-1-phenylethyl)amino]pyridine-4-carbonitrile |
| SMILES | N#Cc1cc(Cl)nc(NC(CO)c2ccccc2)c1 |
| InChI | InChI=1S/C14H12ClN3O/c15-13-6-10(8-16)7-14(18-13)17-12(9-19)11-4-2-1-3-5-11/h1-7,12,19H,9H2,(H,17,18) |
| InChIKey | XWWYOQUVZLPKCI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 68.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|