C17H17ClN4 — CID 133421854
4-[(6-chloro-2-cyclopropylpyrimidin-4-yl)amino]-4-phenylbutanenitrile (PubChem CID 133421854) has the molecular formula C17H17ClN4 and a molecular weight of 312.80 g/mol. Its IUPAC name is 4-[(6-chloro-2-cyclopropylpyrimidin-4-yl)amino]-4-phenylbutanenitrile.
| Compound Name | 4-[(6-chloro-2-cyclopropylpyrimidin-4-yl)amino]-4-phenylbutanenitrile |
|---|---|
| PubChem CID | 133421854 |
| Molecular Formula | C17H17ClN4 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 4-[(6-chloro-2-cyclopropylpyrimidin-4-yl)amino]-4-phenylbutanenitrile |
| SMILES | N#CCCC(Nc1cc(Cl)nc(C2CC2)n1)c1ccccc1 |
| InChI | InChI=1S/C17H17ClN4/c18-15-11-16(22-17(21-15)13-8-9-13)20-14(7-4-10-19)12-5-2-1-3-6-12/h1-3,5-6,11,13-14H,4,7-9H2,(H,20,21,22) |
| InChIKey | XUTRELIVWQAREK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |