C10H10BrFN2O3 — CID 78967831
(2S)-2-[(2-bromo-4-fluorophenyl)carbamoylamino]propanoic acid (PubChem CID 78967831) has the molecular formula C10H10BrFN2O3 and a molecular weight of 305.10 g/mol. Its IUPAC name is (2S)-2-[(2-bromo-4-fluorophenyl)carbamoylamino]propanoic acid.
| Compound Name | (2S)-2-[(2-bromo-4-fluorophenyl)carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 78967831 |
| Molecular Formula | C10H10BrFN2O3 |
| Molecular Weight | 305.10 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | (2S)-2-[(2-bromo-4-fluorophenyl)carbamoylamino]propanoic acid |
| SMILES | C[C@H](NC(=O)Nc1ccc(F)cc1Br)C(=O)O |
| InChI | InChI=1S/C10H10BrFN2O3/c1-5(9(15)16)13-10(17)14-8-3-2-6(12)4-7(8)11/h2-5H,1H3,(H,15,16)(H2,13,14,17)/t5-/m0/s1 |
| InChIKey | ROAMBTOTJNTOKA-YFKPBYRVSA-N |
| XLogP | 2.18 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.10 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |