C12H14FN3O2 — CID 97025761
1-(2-cyano-4-fluorophenyl)-3-[(2R)-1-hydroxybutan-2-yl]urea (PubChem CID 97025761) has the molecular formula C12H14FN3O2 and a molecular weight of 251.26 g/mol. Its IUPAC name is 1-(2-cyano-4-fluorophenyl)-3-[(2R)-1-hydroxybutan-2-yl]urea.
| Compound Name | 1-(2-cyano-4-fluorophenyl)-3-[(2R)-1-hydroxybutan-2-yl]urea |
|---|---|
| PubChem CID | 97025761 |
| Molecular Formula | C12H14FN3O2 |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 1-(2-cyano-4-fluorophenyl)-3-[(2R)-1-hydroxybutan-2-yl]urea |
| SMILES | CC[C@H](CO)NC(=O)Nc1ccc(F)cc1C#N |
| InChI | InChI=1S/C12H14FN3O2/c1-2-10(7-17)15-12(18)16-11-4-3-9(13)5-8(11)6-14/h3-5,10,17H,2,7H2,1H3,(H2,15,16,18)/t10-/m1/s1 |
| InChIKey | FTSJWQKKJIWFPD-SNVBAGLBSA-N |
| XLogP | 1.59 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |