C12H12FN3O4 — CID 82016047
2-[(2-cyano-4-fluorophenyl)carbamoylamino]-3-hydroxybutanoic acid (PubChem CID 82016047) has the molecular formula C12H12FN3O4 and a molecular weight of 281.24 g/mol. Its IUPAC name is 2-[(2-cyano-4-fluorophenyl)carbamoylamino]-3-hydroxybutanoic acid.
| Compound Name | 2-[(2-cyano-4-fluorophenyl)carbamoylamino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 82016047 |
| Molecular Formula | C12H12FN3O4 |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-[(2-cyano-4-fluorophenyl)carbamoylamino]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(NC(=O)Nc1ccc(F)cc1C#N)C(=O)O |
| InChI | InChI=1S/C12H12FN3O4/c1-6(17)10(11(18)19)16-12(20)15-9-3-2-8(13)4-7(9)5-14/h2-4,6,10,17H,1H3,(H,18,19)(H2,15,16,20) |
| InChIKey | BHMBVRCNTNXEIZ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 122.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |