C12H12ClN3O4 — CID 64917691
2-[(5-chloro-2-cyanophenyl)carbamoylamino]-3-hydroxybutanoic acid (PubChem CID 64917691) has the molecular formula C12H12ClN3O4 and a molecular weight of 297.70 g/mol. Its IUPAC name is 2-[(5-chloro-2-cyanophenyl)carbamoylamino]-3-hydroxybutanoic acid.
| Compound Name | 2-[(5-chloro-2-cyanophenyl)carbamoylamino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 64917691 |
| Molecular Formula | C12H12ClN3O4 |
| Molecular Weight | 297.70 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 2-[(5-chloro-2-cyanophenyl)carbamoylamino]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(NC(=O)Nc1cc(Cl)ccc1C#N)C(=O)O |
| InChI | InChI=1S/C12H12ClN3O4/c1-6(17)10(11(18)19)16-12(20)15-9-4-8(13)3-2-7(9)5-14/h2-4,6,10,17H,1H3,(H,18,19)(H2,15,16,20) |
| InChIKey | JCBLUZINRQPIBI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 122.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.70 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |