C14H16ClN3O3 — CID 64918941
2-[(5-chloro-2-cyanophenyl)carbamoylamino]-3,3-dimethylbutanoic acid (PubChem CID 64918941) has the molecular formula C14H16ClN3O3 and a molecular weight of 309.75 g/mol. Its IUPAC name is 2-[(5-chloro-2-cyanophenyl)carbamoylamino]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[(5-chloro-2-cyanophenyl)carbamoylamino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 64918941 |
| Molecular Formula | C14H16ClN3O3 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 2-[(5-chloro-2-cyanophenyl)carbamoylamino]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)C(NC(=O)Nc1cc(Cl)ccc1C#N)C(=O)O |
| InChI | InChI=1S/C14H16ClN3O3/c1-14(2,3)11(12(19)20)18-13(21)17-10-6-9(15)5-4-8(10)7-16/h4-6,11H,1-3H3,(H,19,20)(H2,17,18,21) |
| InChIKey | LSFXTGAYWDBTRM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |