C13H14ClN3O3 — CID 65224623
2-[[(5-chloro-2-cyanophenyl)carbamoylamino]methyl]butanoic acid (PubChem CID 65224623) has the molecular formula C13H14ClN3O3 and a molecular weight of 295.73 g/mol. Its IUPAC name is 2-[[(5-chloro-2-cyanophenyl)carbamoylamino]methyl]butanoic acid.
| Compound Name | 2-[[(5-chloro-2-cyanophenyl)carbamoylamino]methyl]butanoic acid |
|---|---|
| PubChem CID | 65224623 |
| Molecular Formula | C13H14ClN3O3 |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-[[(5-chloro-2-cyanophenyl)carbamoylamino]methyl]butanoic acid |
| SMILES | CCC(CNC(=O)Nc1cc(Cl)ccc1C#N)C(=O)O |
| InChI | InChI=1S/C13H14ClN3O3/c1-2-8(12(18)19)7-16-13(20)17-11-5-10(14)4-3-9(11)6-15/h3-5,8H,2,7H2,1H3,(H,18,19)(H2,16,17,20) |
| InChIKey | JEHDOLZXBWNGFK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |