C14H17N3O3 — CID 103927534
(2R)-2-[(2-cyanophenyl)carbamoylamino]-3,3-dimethylbutanoic acid (PubChem CID 103927534) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is (2R)-2-[(2-cyanophenyl)carbamoylamino]-3,3-dimethylbutanoic acid.
| Compound Name | (2R)-2-[(2-cyanophenyl)carbamoylamino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 103927534 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (2R)-2-[(2-cyanophenyl)carbamoylamino]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)[C@@H](NC(=O)Nc1ccccc1C#N)C(=O)O |
| InChI | InChI=1S/C14H17N3O3/c1-14(2,3)11(12(18)19)17-13(20)16-10-7-5-4-6-9(10)8-15/h4-7,11H,1-3H3,(H,18,19)(H2,16,17,20)/t11-/m0/s1 |
| InChIKey | VSSRJZCXOVQMMA-NSHDSACASA-N |
| XLogP | 2.18 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |