3,3-dimethyl-2-[(2-methylphenyl)carbamoylamino]butanoic acid

C14H20N2O3 — CID 61196857

IUPAC3,3-dimethyl-2-[(2-methylphenyl)carbamoylamino]butanoic acid
SMILESCc1ccccc1NC(=O)NC(C(=O)O)C(C)(C)C
InChIInChI=1S/C14H20N2O3/c1-9-7-5-6-8-10(9)15-13(19)16-11(12(17)18)14(2,3)4/h5-8,11H,1-4H3,(H,17,18)(H2,15,16,19)
InChIKeyHXNALSODBCUJPV-UHFFFAOYSA-N
MW264.32 g/mol
LogP2.62
Rot. Bonds3

About 3,3-dimethyl-2-[(2-methylphenyl)carbamoylamino]butanoic acid

3,3-dimethyl-2-[(2-methylphenyl)carbamoylamino]butanoic acid (PubChem CID 61196857) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 3,3-dimethyl-2-[(2-methylphenyl)carbamoylamino]butanoic acid.

Molecular Properties

Compound Name3,3-dimethyl-2-[(2-methylphenyl)carbamoylamino]butanoic acid
PubChem CID61196857
Molecular FormulaC14H20N2O3
Molecular Weight264.32 g/mol
Exact Mass264.15
IUPAC Name3,3-dimethyl-2-[(2-methylphenyl)carbamoylamino]butanoic acid
SMILESCc1ccccc1NC(=O)NC(C(=O)O)C(C)(C)C
InChIInChI=1S/C14H20N2O3/c1-9-7-5-6-8-10(9)15-13(19)16-11(12(17)18)14(2,3)4/h5-8,11H,1-4H3,(H,17,18)(H2,15,16,19)
InChIKeyHXNALSODBCUJPV-UHFFFAOYSA-N
XLogP2.62
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.32
LogP ≤ 52.62
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze 3,3-dimethyl-2-[(2-methylphenyl)carbamoylamino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,3-dimethyl-2-[(2-methylphenyl)carbamoylamino]butanoic acid?
The IUPAC name of 3,3-dimethyl-2-[(2-methylphenyl)carbamoylamino]butanoic acid (CID 61196857) is 3,3-dimethyl-2-[(2-methylphenyl)carbamoylamino]butanoic acid.
What is the SMILES notation for 3,3-dimethyl-2-[(2-methylphenyl)carbamoylamino]butanoic acid?
The canonical SMILES for 3,3-dimethyl-2-[(2-methylphenyl)carbamoylamino]butanoic acid is Cc1ccccc1NC(=O)NC(C(=O)O)C(C)(C)C.
What is the InChIKey of 3,3-dimethyl-2-[(2-methylphenyl)carbamoylamino]butanoic acid?
The InChIKey is HXNALSODBCUJPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O3/c1-9-7-5-6-8-10(9)15-13(19)16-11(12(17)18)14(2,3)4/h5-8,11H,1-4H3,(H,17,18)(H2,15,16,19).
What are the key properties of 3,3-dimethyl-2-[(2-methylphenyl)carbamoylamino]butanoic acid?
3,3-dimethyl-2-[(2-methylphenyl)carbamoylamino]butanoic acid has a molecular weight of 264.32 g/mol, XLogP of 2.62, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-2-[(2-methylphenyl)carbamoylamino]butanoic acid is sourced from PubChem (CID 61196857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).