C19H19NO2S — CID 9366374
N-[(1S)-1-(1-benzofuran-2-yl)ethyl]-3-phenylsulfanylpropanamide (PubChem CID 9366374) has the molecular formula C19H19NO2S and a molecular weight of 325.43 g/mol. Its IUPAC name is N-[(1S)-1-(1-benzofuran-2-yl)ethyl]-3-phenylsulfanylpropanamide.
| Compound Name | N-[(1S)-1-(1-benzofuran-2-yl)ethyl]-3-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 9366374 |
| Molecular Formula | C19H19NO2S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | N-[(1S)-1-(1-benzofuran-2-yl)ethyl]-3-phenylsulfanylpropanamide |
| SMILES | C[C@H](NC(=O)CCSc1ccccc1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H19NO2S/c1-14(18-13-15-7-5-6-10-17(15)22-18)20-19(21)11-12-23-16-8-3-2-4-9-16/h2-10,13-14H,11-12H2,1H3,(H,20,21)/t14-/m0/s1 |
| InChIKey | JWGZNOGWZPYSPE-AWEZNQCLSA-N |
| XLogP | 4.79 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |