C20H15N2O5S2- — CID 57240119
2-[[2-(hydroxyamino)-2-oxo-1-phenylethyl]-sulfinatoamino]phenoxathiine (PubChem CID 57240119) has the molecular formula C20H15N2O5S2- and a molecular weight of 427.48 g/mol. Its IUPAC name is 2-[[2-(hydroxyamino)-2-oxo-1-phenylethyl]-sulfinatoamino]phenoxathiine.
| Compound Name | 2-[[2-(hydroxyamino)-2-oxo-1-phenylethyl]-sulfinatoamino]phenoxathiine |
|---|---|
| PubChem CID | 57240119 |
| Molecular Formula | C20H15N2O5S2- |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | 2-[[2-(hydroxyamino)-2-oxo-1-phenylethyl]-sulfinatoamino]phenoxathiine |
| SMILES | O=C(NO)C(c1ccccc1)N(c1ccc2c(c1)Sc1ccccc1O2)S(=O)[O-] |
| InChI | InChI=1S/C20H16N2O5S2/c23-20(21-24)19(13-6-2-1-3-7-13)22(29(25)26)14-10-11-16-18(12-14)28-17-9-5-4-8-15(17)27-16/h1-12,19,24H,(H,21,23)(H,25,26)/p-1 |
| InChIKey | ABDKUNNHIFSHFC-UHFFFAOYSA-M |
| XLogP | 3.79 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|