C21H17N2O6S2- — CID 57017821
2-[[1-(hydroxyamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-sulfinatoamino]phenoxathiine (PubChem CID 57017821) has the molecular formula C21H17N2O6S2- and a molecular weight of 457.51 g/mol. Its IUPAC name is 2-[[1-(hydroxyamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-sulfinatoamino]phenoxathiine.
| Compound Name | 2-[[1-(hydroxyamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-sulfinatoamino]phenoxathiine |
|---|---|
| PubChem CID | 57017821 |
| Molecular Formula | C21H17N2O6S2- |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | 2-[[1-(hydroxyamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-sulfinatoamino]phenoxathiine |
| SMILES | O=C(NO)C(Cc1ccc(O)cc1)N(c1ccc2c(c1)Sc1ccccc1O2)S(=O)[O-] |
| InChI | InChI=1S/C21H18N2O6S2/c24-15-8-5-13(6-9-15)11-16(21(25)22-26)23(31(27)28)14-7-10-18-20(12-14)30-19-4-2-1-3-17(19)29-18/h1-10,12,16,24,26H,11H2,(H,22,25)(H,27,28)/p-1 |
| InChIKey | PBVDZLLIFUVVKU-UHFFFAOYSA-M |
| XLogP | 3.37 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|