C22H25N3O5S2 — CID 170380890
(2R)-2-[[4-(dimethylamino)phenyl]methyl-(4-hydroxyphenyl)sulfonylamino]-N-hydroxy-3-thiophen-2-ylpropanamide (PubChem CID 170380890) has the molecular formula C22H25N3O5S2 and a molecular weight of 475.59 g/mol. Its IUPAC name is (2R)-2-[[4-(dimethylamino)phenyl]methyl-(4-hydroxyphenyl)sulfonylamino]-N-hydroxy-3-thiophen-2-ylpropanamide.
| Compound Name | (2R)-2-[[4-(dimethylamino)phenyl]methyl-(4-hydroxyphenyl)sulfonylamino]-N-hydroxy-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 170380890 |
| Molecular Formula | C22H25N3O5S2 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | (2R)-2-[[4-(dimethylamino)phenyl]methyl-(4-hydroxyphenyl)sulfonylamino]-N-hydroxy-3-thiophen-2-ylpropanamide |
| SMILES | CN(C)c1ccc(CN([C@H](Cc2cccs2)C(=O)NO)S(=O)(=O)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C22H25N3O5S2/c1-24(2)17-7-5-16(6-8-17)15-25(32(29,30)20-11-9-18(26)10-12-20)21(22(27)23-28)14-19-4-3-13-31-19/h3-13,21,26,28H,14-15H2,1-2H3,(H,23,27)/t21-/m1/s1 |
| InChIKey | ZCFWDGZIDQNKFD-OAQYLSRUSA-N |
| XLogP | 2.83 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|