C22H23ClN2O3S2 — CID 47027380
5-[(4-chlorophenyl)methyl-(1-thiophen-2-ylpropan-2-yl)sulfamoyl]-2-methylbenzamide (PubChem CID 47027380) has the molecular formula C22H23ClN2O3S2 and a molecular weight of 463.02 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)methyl-(1-thiophen-2-ylpropan-2-yl)sulfamoyl]-2-methylbenzamide.
| Compound Name | 5-[(4-chlorophenyl)methyl-(1-thiophen-2-ylpropan-2-yl)sulfamoyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 47027380 |
| Molecular Formula | C22H23ClN2O3S2 |
| Molecular Weight | 463.02 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | 5-[(4-chlorophenyl)methyl-(1-thiophen-2-ylpropan-2-yl)sulfamoyl]-2-methylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)N(Cc2ccc(Cl)cc2)C(C)Cc2cccs2)cc1C(N)=O |
| InChI | InChI=1S/C22H23ClN2O3S2/c1-15-5-10-20(13-21(15)22(24)26)30(27,28)25(14-17-6-8-18(23)9-7-17)16(2)12-19-4-3-11-29-19/h3-11,13,16H,12,14H2,1-2H3,(H2,24,26) |
| InChIKey | PXGFTCBKXCSEKZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.02 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |