C16H17ClN2O3S — CID 34035463
5-[(2-chlorophenyl)methyl-methylsulfamoyl]-2-methylbenzamide (PubChem CID 34035463) has the molecular formula C16H17ClN2O3S and a molecular weight of 352.84 g/mol. Its IUPAC name is 5-[(2-chlorophenyl)methyl-methylsulfamoyl]-2-methylbenzamide.
| Compound Name | 5-[(2-chlorophenyl)methyl-methylsulfamoyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 34035463 |
| Molecular Formula | C16H17ClN2O3S |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 5-[(2-chlorophenyl)methyl-methylsulfamoyl]-2-methylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)Cc2ccccc2Cl)cc1C(N)=O |
| InChI | InChI=1S/C16H17ClN2O3S/c1-11-7-8-13(9-14(11)16(18)20)23(21,22)19(2)10-12-5-3-4-6-15(12)17/h3-9H,10H2,1-2H3,(H2,18,20) |
| InChIKey | VEHTVSLSBQBXSB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |